2-((4-(Thiophen-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl)oxy)ethan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F680185 |
---|---|
Product Name | 2-((4-(Thiophen-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl)oxy)ethan-1-amine |
Other Names | (2-{[4-(2-thienyl)-6-(trifluoromethyl)pyrimidin-2-yl]oxy}ethyl)amine |
CAS | 1160246-48-9 |
Purity | 95% |
Molecular weight | 289.28 |
IUPAC Name | 2-{[4-(thiophen-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl]oxy}ethan-1-amine |
SMILES | NCCOC1=NC(=CC(=N1)C(F)(F)F)C1=CC=CS1 |
INCHI Code | InChI=1S/C11H10F3N3OS/c12-11(13,14)9-6-7(8-2-1-5-19-8)16-10(17-9)18-4-3-15/h1-2,5-6H,3-4,15H2 |
Asymmetric atoms | 0 |
LogP | 2.847789 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.27272728 |
Concept Codes | Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Sulfide, Fluoro, Halo, Trifluoromethyl, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyrimidine, Thiophene, Cyclic, Aromatic, PFA01, PFA02 |