3-Fluoro-4-(furan-2-ylmethoxy)aniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F680148 |
---|---|
Product Name | 3-Fluoro-4-(furan-2-ylmethoxy)aniline |
Other Names | 3-Fluoro-4-(furan-2-ylmethoxy)-phenylamine |
CAS | 937598-39-5 |
Purity | 97% |
Molecular weight | 207.204 |
IUPAC Name | 3-fluoro-4-[(furan-2-yl)methoxy]aniline |
SMILES | NC1=CC(F)=C(OCC2=CC=CO2)C=C1 |
INCHI Code | InChI=1S/C11H10FNO2/c12-10-6-8(13)3-4-11(10)15-7-9-2-1-5-14-9/h1-6H,7,13H2 |
Asymmetric atoms | 0 |
LogP | 1.9140702 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.09090909 |
Concept Codes | Phenyl, Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Fluoro, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Disubstituted (2,5)- monofluorobenzene, Furan, Monofluorobenzene, Aniline, Cyclic, Aromatic |