2,3,4,5-Tetrahydro-1h-pyrido[4,3-b]indole-8-carboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F679926 |
---|---|
Product Name | 2,3,4,5-Tetrahydro-1h-pyrido[4,3-b]indole-8-carboxylic acid |
CAS | 929345-60-8 |
Purity | 95% |
Molecular weight | 216.24 |
IUPAC Name | 1H,2H,3H,4H,5H-pyrido[4,3-b]indole-8-carboxylic acid |
SMILES | OC(=O)C1=CC=C2NC3=C(CNCC3)C2=C1 |
INCHI Code | InChI=1S/C12H12N2O2/c15-12(16)7-1-2-10-8(5-7)9-6-13-4-3-11(9)14-10/h1-2,5,13-14H,3-4,6H2,(H,15,16) |
Asymmetric atoms | 0 |
LogP | -1.4534038 |
H bond acceptors | 3 |
H bond donors | 3 |
fsp3 | 0.25 |
Concept Codes | Carboxylic acid, Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Amino acid, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heterocycle, Cyclic, Aromatic, Pyrido[4,3-b]indole |