6-[4-(1H-imidazol-1-yl)phenyl]-2,3-dihydropyridazin-3-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F678424 |
---|---|
Product Name | 6-[4-(1H-imidazol-1-yl)phenyl]-2,3-dihydropyridazin-3-one |
CAS | 84243-59-4 |
Purity | 98% |
Molecular weight | 238.25 |
IUPAC Name | 6-[4-(1H-imidazol-1-yl)phenyl]-2,3-dihydropyridazin-3-one |
SMILES | O=C1NN=C(C=C1)C1=CC=C(C=C1)N1C=CN=C1 |
INCHI Code | InChI=1S/C13H10N4O/c18-13-6-5-12(15-16-13)10-1-3-11(4-2-10)17-8-7-14-9-17/h1-9H,(H,16,18) |
Asymmetric atoms | 0 |
LogP | 1.1230471 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Phenyl, Heterocycle, Heteroaromatic, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heteroaromatic, 6-Membered heterocycle, Imidazole, Pyridazine, Cyclic, Aromatic |