2-(Phenoxymethyl)pyrrolidine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F677972 |
---|---|
Product Name | 2-(Phenoxymethyl)pyrrolidine |
CAS | 383127-73-9 |
Purity | 95% |
Molecular weight | 177.247 |
IUPAC Name | 2-(phenoxymethyl)pyrrolidine |
SMILES | C(OC1=CC=CC=C1)C1CCCN1 |
INCHI Code | InChI=1/C11H15NO/c1-2-6-11(7-3-1)13-9-10-5-4-8-12-10/h1-3,6-7,10,12H,4-5,8-9H2 |
Asymmetric atoms | 1 |
LogP | 1.9167356 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.45454547 |
Concept Codes | Phenyl, Ether, Heterocycle, Secondary amine, Amine (P+S+T), 5-Membered heterocycle, Pyrrolidine, Cyclic, Aromatic |