1-(4-Bromothiophen-2-yl)-N-(thiophen-2-ylmethyl)methanamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F676655 |
---|---|
Product Name | 1-(4-Bromothiophen-2-yl)-N-(thiophen-2-ylmethyl)methanamine |
CAS | 1039801-96-1 |
Purity | 95% |
Molecular weight | 288.22 |
IUPAC Name | [(4-bromothiophen-2-yl)methyl][(thiophen-2-yl)methyl]amine |
SMILES | BrC1=CSC(CNCC2=CC=CS2)=C1 |
INCHI Code | InChI=1S/C10H10BrNS2/c11-8-4-10(14-7-8)6-12-5-9-2-1-3-13-9/h1-4,7,12H,5-6H2 |
Asymmetric atoms | 0 |
LogP | 3.850583 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.2 |
Concept Codes | Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Sulfide, Bromo, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |