Methyl 2-(chlorosulfonyl)-2-methylpropanoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F676280 |
---|---|
Product Name | Methyl 2-(chlorosulfonyl)-2-methylpropanoate |
CAS | 55896-98-5 |
Purity | 95% |
Molecular weight | 200.63 |
IUPAC Name | methyl 2-(chlorosulfonyl)-2-methylpropanoate |
SMILES | COC(=O)C(C)(C)S(Cl)(=O)=O |
INCHI Code | InChI=1S/C5H9ClO4S/c1-5(2,4(7)10-3)11(6,8)9/h1-3H3 |
Asymmetric atoms | 0 |
LogP | 0.8869979 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.8 |
Concept Codes | Ester, Sulfonyl chloride, Chloro, Halo, Sulfonyl Chloride (RSO2Cl, R = C) |