1-(3,5-Dimethyladamantan-1-yl)ethan-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F675492 |
---|---|
Product Name | 1-(3,5-Dimethyladamantan-1-yl)ethan-1-one |
CAS | 40430-57-7 |
Purity | 98% |
Molecular weight | 206.329 |
IUPAC Name | 1-(3,5-dimethyladamantan-1-yl)ethan-1-one |
SMILES | CC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
INCHI Code | InChI=1/C14H22O/c1-10(15)14-6-11-4-12(2,8-14)7-13(3,5-11)9-14/h11H,4-9H2,1-3H3 |
Asymmetric atoms | 2 |
LogP | 3.3094962 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.9285714 |
Concept Codes | Ketone, Methyl, Dimethyl, Adamantane, Cyclic |