3-{[(tert-butoxy)carbonyl]amino}-2,2,3-trimethylbutanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F674672 |
---|---|
Product Name | 3-{[(tert-butoxy)carbonyl]amino}-2,2,3-trimethylbutanoic acid |
CAS | 1375471-46-7 |
Purity | 95% |
Molecular weight | 245.319 |
IUPAC Name | 3-{[(tert-butoxy)carbonyl]amino}-2,2,3-trimethylbutanoic acid |
SMILES | CC(C)(C)OC(=O)NC(C)(C)C(C)(C)C(O)=O |
INCHI Code | InChI=1S/C12H23NO4/c1-10(2,3)17-9(16)13-12(6,7)11(4,5)8(14)15/h1-7H3,(H,13,16)(H,14,15) |
Asymmetric atoms | 0 |
LogP | 2.3777869 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.8333333 |
Concept Codes | Carboxylic acid, Secondary amine, Amine (P+S+T), NBOC, Carbamate, Amino acid |