3-(4-Nitrophenyl)adamantan-1-ol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F671867 |
---|---|
Product Name | 3-(4-Nitrophenyl)adamantan-1-ol |
CAS | 42009-76-7 |
Purity | 98% |
Molecular weight | 273.332 |
IUPAC Name | 3-(4-nitrophenyl)adamantan-1-ol |
SMILES | OC12CC3CC(C1)CC(C3)(C2)C1=CC=C(C=C1)[N+]([O-])=O |
INCHI Code | InChI=1/C16H19NO3/c18-16-8-11-5-12(9-16)7-15(6-11,10-16)13-1-3-14(4-2-13)17(19)20/h1-4,11-12,18H,5-10H2 |
Asymmetric atoms | 2 |
LogP | 2.9466646 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.625 |
Concept Codes | Phenyl, Aliphatic alcohol, Nitro, Adamantane, Nitrobenzene, Cyclic, Aromatic |