3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-ol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F671796 |
---|---|
Product Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-ol |
CAS | 32229-98-4 |
Purity | 98% |
Molecular weight | 254.76 |
IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]propan-1-ol |
SMILES | OCCCN1CCN(CC1)C1=CC=CC(Cl)=C1 |
INCHI Code | InChI=1S/C13H19ClN2O/c14-12-3-1-4-13(11-12)16-8-6-15(7-9-16)5-2-10-17/h1,3-4,11,17H,2,5-10H2 |
Asymmetric atoms | 0 |
LogP | 1.9023117 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.53846157 |
Concept Codes | Phenyl, Aliphatic alcohol, Heterocycle, Tertiary amine, Amine (P+S+T), Chloro, Halo, Diamine, 6-Membered heterocycle, Monochlorobenzene, Monosubstituted (meta) monochlorobenzene, Piperazine, Cyclic, Aromatic |