2-(4-Fluoro-2-nitrophenyl)acetonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F669660 |
---|---|
Product Name | 2-(4-Fluoro-2-nitrophenyl)acetonitrile |
CAS | 708-58-7 |
Purity | 95+% |
Molecular weight | 180.138 |
IUPAC Name | 2-(4-fluoro-2-nitrophenyl)acetonitrile |
SMILES | [O-][N+](=O)C1=C(CC#N)C=CC(F)=C1 |
INCHI Code | InChI=1S/C8H5FN2O2/c9-7-2-1-6(3-4-10)8(5-7)11(12)13/h1-2,5H,3H2 |
Asymmetric atoms | 0 |
LogP | 1.7516291 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Nitrile, Nitro, Fluoro, Halo, Disubstituted (3,4)- monofluorobenzene, Monofluorobenzene, Nitrobenzene, Cyclic, Aromatic |