6-(4-Iodophenyl)hexanoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F669101 |
---|---|
Product Name | 6-(4-Iodophenyl)hexanoic acid |
CAS | 256486-41-6 |
Purity | 95% |
Molecular weight | 318.154 |
IUPAC Name | 6-(4-iodophenyl)hexanoic acid |
SMILES | OC(=O)CCCCCC1=CC=C(I)C=C1 |
INCHI Code | InChI=1S/C12H15IO2/c13-11-8-6-10(7-9-11)4-2-1-3-5-12(14)15/h6-9H,1-5H2,(H,14,15) |
Asymmetric atoms | 0 |
LogP | 4.3182135 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.41666666 |
Concept Codes | Phenyl, Carboxylic acid, Iodo, Halo, Monoiodobenzenes, Monosubstituted (para) monoiodobenzene, Cyclic, Aromatic |