(6-Methoxypyrazin-2-yl)methanol
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F668557 |
---|---|
Product Name | (6-Methoxypyrazin-2-yl)methanol |
CAS | 1503211-90-2 |
Purity | 98% |
Molecular weight | 140.142 |
IUPAC Name | (6-methoxypyrazin-2-yl)methanol |
SMILES | COC1=NC(CO)=CN=C1 |
INCHI Code | InChI=1S/C6H8N2O2/c1-10-6-3-7-2-5(4-9)8-6/h2-3,9H,4H2,1H3 |
Asymmetric atoms | 0 |
LogP | -0.71119064 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.33333334 |
Concept Codes | Aliphatic alcohol, Methoxy, Ether, Heterocycle, Heteroaromatic, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyrazine, Cyclic, Aromatic |