5-Nitro-2-(pyridin-4-yl)-2,3-dihydro-1h-isoindole-1,3-dione
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F665730 |
---|---|
Product Name | 5-Nitro-2-(pyridin-4-yl)-2,3-dihydro-1h-isoindole-1,3-dione |
CAS | 404896-26-0 |
Purity | 95% |
Molecular weight | 269.216 |
IUPAC Name | 5-nitro-2-(pyridin-4-yl)-2,3-dihydro-1H-isoindole-1,3-dione |
SMILES | [O-][N+](=O)C1=CC2=C(C=C1)C(=O)N(C2=O)C1=CC=NC=C1 |
INCHI Code | InChI=1S/C13H7N3O4/c17-12-10-2-1-9(16(19)20)7-11(10)13(18)15(12)8-3-5-14-6-4-8/h1-7H |
Asymmetric atoms | 0 |
LogP | 1.2973694 |
H bond acceptors | 5 |
H bond donors | 0 |
fsp3 | 0.0 |
Concept Codes | Heterocycle, Heteroaromatic, Imide, Nitro, Lactam, 5-Membered heterocycle, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyridine, Cyclic, Aromatic, Isoindoline, Phthalimide |