5-Chlorothiophene-2-carbothioamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F665059 |
---|---|
Product Name | 5-Chlorothiophene-2-carbothioamide |
CAS | 85347-12-2 |
Purity | 95% |
Molecular weight | 177.66 |
IUPAC Name | 5-chlorothiophene-2-carbothioamide |
SMILES | NC(=S)C1=CC=C(Cl)S1 |
INCHI Code | InChI=1S/C5H4ClNS2/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H2,7,8) |
Asymmetric atoms | 0 |
LogP | 2.3966777 |
H bond acceptors | 0 |
H bond donors | 1 |
fsp3 | 0.0 |
Concept Codes | Heterocycle, Heteroaromatic, Sulfide, Chloro, Halo, Thioamide, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |