2-[(4-bromo-2-methylphenoxy)methyl]oxirane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F664711 |
---|---|
Product Name | 2-[(4-bromo-2-methylphenoxy)methyl]oxirane |
CAS | 1343109-94-3 |
Purity | 98% |
Molecular weight | 243.1 |
IUPAC Name | 2-[(4-bromo-2-methylphenoxy)methyl]oxirane |
SMILES | CC1=CC(Br)=CC=C1OCC1CO1 |
INCHI Code | InChI=1/C10H11BrO2/c1-7-4-8(11)2-3-10(7)13-6-9-5-12-9/h2-4,9H,5-6H2,1H3 |
Asymmetric atoms | 1 |
LogP | 2.9390152 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Ether, Heterocycle, Bromo, Halo, Methyl, Tolyl, 3-Membered heterocycle, Disubstituted (3,4)- monobromobenzene, Monobromobenzene, Oxirane, Cyclic, Aromatic |