n-(Oxolan-3-ylmethyl)cyclopropanamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F663164 |
---|---|
Product Name | n-(Oxolan-3-ylmethyl)cyclopropanamine |
Other Names | N-(tetrahydrofuran-3-ylmethyl)cyclopropanamine |
CAS | 926239-80-7 |
Purity | 98% |
Molecular weight | 141.214 |
IUPAC Name | N-[(oxolan-3-yl)methyl]cyclopropanamine |
SMILES | C(NC1CC1)C1CCOC1 |
INCHI Code | InChI=1/C8H15NO/c1-2-8(1)9-5-7-3-4-10-6-7/h7-9H,1-6H2 |
Asymmetric atoms | 1 |
LogP | 0.29146096 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Ether, Heterocycle, Secondary amine, Amine (P+S+T), 5-Membered heterocycle, Tetrahydrofuran, Cyclic, Cyclopropane |