Tert-butyl n-[carbamimidoyl(cyclohexyl)methyl]carbamate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F662276 |
---|---|
Product Name | Tert-butyl n-[carbamimidoyl(cyclohexyl)methyl]carbamate |
CAS | 1341344-97-5 |
Purity | 98% |
Molecular weight | 255.362 |
IUPAC Name | tert-butyl N-[carbamimidoyl(cyclohexyl)methyl]carbamate |
SMILES | CC(C)(C)OC(=O)NC(C1CCCCC1)C(N)=N |
INCHI Code | InChI=1/C13H25N3O2/c1-13(2,3)18-12(17)16-10(11(14)15)9-7-5-4-6-8-9/h9-10H,4-8H2,1-3H3,(H3,14,15)(H,16,17) |
Asymmetric atoms | 1 |
LogP | 1.9337469 |
H bond acceptors | 3 |
H bond donors | 3 |
fsp3 | 0.84615386 |
Concept Codes | Secondary amine, Amine (P+S+T), NBOC, Carbamate, Amidine, Cyclohexane, Cyclic |