2-(3-Hydroxyphenyl)-2-(methylamino)acetonitrile
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F661745 |
---|---|
Product Name | 2-(3-Hydroxyphenyl)-2-(methylamino)acetonitrile |
CAS | 1040056-60-7 |
Purity | 95% |
Molecular weight | 162.192 |
IUPAC Name | 2-(3-hydroxyphenyl)-2-(methylamino)acetonitrile |
SMILES | CNC(C#N)C1=CC=CC(O)=C1 |
INCHI Code | InChI=1/C9H10N2O/c1-11-9(6-10)7-3-2-4-8(12)5-7/h2-5,9,11-12H,1H3 |
Asymmetric atoms | 1 |
LogP | 0.9759178 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.22222222 |
Concept Codes | Phenyl, Secondary amine, Amine (P+S+T), Nitrile, N-methyl, Aromatic alcohol, Phenol, Cyclic, Aromatic |