Tert-butyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F660652 |
---|---|
Product Name | Tert-butyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
CAS | 791822-64-5 |
Purity | 95% |
Molecular weight | 233.311 |
IUPAC Name | tert-butyl 1,2,3,4-tetrahydroisoquinoline-1-carboxylate |
SMILES | CC(C)(C)OC(=O)C1NCCC2=C1C=CC=C2 |
INCHI Code | InChI=1/C14H19NO2/c1-14(2,3)17-13(16)12-11-7-5-4-6-10(11)8-9-15-12/h4-7,12,15H,8-9H2,1-3H3 |
Asymmetric atoms | 1 |
LogP | 2.4612765 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.5 |
Concept Codes | Ester, Heterocycle, Secondary amine, Amine (P+S+T), Amino acid ester, 6-Membered heterocycle, Cyclic, Aromatic, Alpha-amino acid |