3-({[(tert-butoxy)carbonyl]amino}methyl)furan-2-carboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F660543 |
---|---|
Product Name | 3-({[(tert-butoxy)carbonyl]amino}methyl)furan-2-carboxylic acid |
CAS | 903094-62-2 |
Purity | 95% |
Molecular weight | 241.243 |
IUPAC Name | 3-({[(tert-butoxy)carbonyl]amino}methyl)furan-2-carboxylic acid |
SMILES | CC(C)(C)OC(=O)NCC1=C(OC=C1)C(O)=O |
INCHI Code | InChI=1S/C11H15NO5/c1-11(2,3)17-10(15)12-6-7-4-5-16-8(7)9(13)14/h4-5H,6H2,1-3H3,(H,12,15)(H,13,14) |
Asymmetric atoms | 0 |
LogP | 1.3089412 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.45454547 |
Concept Codes | Carboxylic acid, Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), NBOC, Carbamate, Amino acid, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Cyclic, Aromatic |