2-Cyclopropyl-4-methyl-6-(methylsulfanyl)pyrimidine-5-carboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F659245 |
---|---|
Product Name | 2-Cyclopropyl-4-methyl-6-(methylsulfanyl)pyrimidine-5-carboxylic acid |
CAS | 929975-15-5 |
Purity | 95% |
Molecular weight | 224.28 |
IUPAC Name | 2-cyclopropyl-4-methyl-6-(methylsulfanyl)pyrimidine-5-carboxylic acid |
SMILES | CSC1=C(C(O)=O)C(C)=NC(=N1)C1CC1 |
INCHI Code | InChI=1S/C10H12N2O2S/c1-5-7(10(13)14)9(15-2)12-8(11-5)6-3-4-6/h6H,3-4H2,1-2H3,(H,13,14) |
Asymmetric atoms | 0 |
LogP | 1.6399664 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.5 |
Concept Codes | Carboxylic acid, Heterocycle, Heteroaromatic, Sulfide, Methyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Pyrimidine, Cyclic, Aromatic, Cyclopropane |