2-Methyl-6-(4-methylphenyl)morpholine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F659235 |
---|---|
Product Name | 2-Methyl-6-(4-methylphenyl)morpholine |
CAS | 1099679-60-3 |
Purity | 98% |
Molecular weight | 191.274 |
IUPAC Name | 2-methyl-6-(4-methylphenyl)morpholine |
SMILES | CC1CNCC(O1)C1=CC=C(C)C=C1 |
INCHI Code | InChI=1/C12H17NO/c1-9-3-5-11(6-4-9)12-8-13-7-10(2)14-12/h3-6,10,12-13H,7-8H2,1-2H3 |
Asymmetric atoms | 2 |
LogP | 2.3028576 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.5 |
Concept Codes | Phenyl, Ether, Heterocycle, Secondary amine, Amine (P+S+T), Methyl, Tolyl, Dimethyl, 6-Membered heterocycle, Morpholine, Cyclic, Aromatic, 1,4-Oxazinane, Oxazinane |