2-({8-methylimidazo[1,2-a]pyridin-2-yl}methoxy)benzoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F659233 |
---|---|
Product Name | 2-({8-methylimidazo[1,2-a]pyridin-2-yl}methoxy)benzoic acid |
CAS | 929975-05-3 |
Purity | 95% |
Molecular weight | 282.299 |
IUPAC Name | 2-({8-methylimidazo[1,2-a]pyridin-2-yl}methoxy)benzoic acid |
SMILES | CC1=CC=CN2C=C(COC3=CC=CC=C3C(O)=O)N=C12 |
INCHI Code | InChI=1S/C16H14N2O3/c1-11-5-4-8-18-9-12(17-15(11)18)10-21-14-7-3-2-6-13(14)16(19)20/h2-9H,10H2,1H3,(H,19,20) |
Asymmetric atoms | 0 |
LogP | 0.8772311 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Carboxylic acid, Ether, Heterocycle, Heteroaromatic, Methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heteroaromatic, 6-Membered heterocycle, Cyclic, Aromatic, Benzoic acid |