2-Oxooxolan-3-yl 2,2-diphenylacetate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F658742 |
---|---|
Product Name | 2-Oxooxolan-3-yl 2,2-diphenylacetate |
CAS | 453550-77-1 |
Purity | 98% |
Molecular weight | 296.322 |
IUPAC Name | 2-oxooxolan-3-yl 2,2-diphenylacetate |
SMILES | O=C(OC1CCOC1=O)C(C1=CC=CC=C1)C1=CC=CC=C1 |
INCHI Code | InChI=1/C18H16O4/c19-17-15(11-12-21-17)22-18(20)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
Asymmetric atoms | 1 |
LogP | 3.1579468 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.22222222 |
Concept Codes | Phenyl, Ester, Heterocycle, Lactone, 5-Membered heterocycle, Tetrahydrofuran, Cyclic, Aromatic, Benzhydryl |