3-Chloro-n-(2-phenylphenyl)propanamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F658685 |
---|---|
Product Name | 3-Chloro-n-(2-phenylphenyl)propanamide |
Other Names | N-1,1'-biphenyl-2-yl-3-chloropropanamide |
CAS | 86199-14-6 |
Purity | 95% |
Molecular weight | 259.73 |
IUPAC Name | N-{[1,1'-biphenyl]-2-yl}-3-chloropropanamide |
SMILES | ClCCC(=O)NC1=CC=CC=C1C1=CC=CC=C1 |
INCHI Code | InChI=1S/C15H14ClNO/c16-11-10-15(18)17-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-9H,10-11H2,(H,17,18) |
Asymmetric atoms | 0 |
LogP | 3.632538 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.13333334 |
Concept Codes | Phenyl, Amide, Chloro, Halo, Cyclic, Aromatic, Biphenyl |