2-(2,4-Dichlorobenzamido)-5-methylbenzoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F658439 |
---|---|
Product Name | 2-(2,4-Dichlorobenzamido)-5-methylbenzoic acid |
CAS | 518021-63-1 |
Purity | 97% |
Molecular weight | 324.16 |
IUPAC Name | 2-(2,4-dichlorobenzamido)-5-methylbenzoic acid |
SMILES | CC1=CC=C(NC(=O)C2=CC=C(Cl)C=C2Cl)C(=C1)C(O)=O |
INCHI Code | InChI=1S/C15H11Cl2NO3/c1-8-2-5-13(11(6-8)15(20)21)18-14(19)10-4-3-9(16)7-12(10)17/h2-7H,1H3,(H,18,19)(H,20,21) |
Asymmetric atoms | 0 |
LogP | 5.0942245 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.06666667 |
Concept Codes | Phenyl, Carboxylic acid, Amide, Chloro, Halo, Methyl, Tolyl, 1,3-Dichlorobenzene, Dichlorobenzene, Cyclic, Aromatic, Benzanilide, Benzoic acid |