2-(2-Bromophenyl)-1-(furan-2-yl)ethan-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F656757 |
---|---|
Product Name | 2-(2-Bromophenyl)-1-(furan-2-yl)ethan-1-one |
CAS | 1247140-46-0 |
Purity | 95% |
Molecular weight | 265.106 |
IUPAC Name | 2-(2-bromophenyl)-1-(furan-2-yl)ethan-1-one |
SMILES | BrC1=CC=CC=C1CC(=O)C1=CC=CO1 |
INCHI Code | InChI=1S/C12H9BrO2/c13-10-5-2-1-4-9(10)8-11(14)12-6-3-7-15-12/h1-7H,8H2 |
Asymmetric atoms | 0 |
LogP | 3.1942325 |
H bond acceptors | 1 |
H bond donors | 0 |
fsp3 | 0.083333336 |
Concept Codes | Phenyl, Ketone, Heterocycle, Heteroaromatic, Bromo, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Monobromobenzene, Monosubstituted (ortho) monobromobenzene, Cyclic, Aromatic |