Methyl({1-[2-(trifluoromethyl)phenyl]propan-2-yl})amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F656433 |
---|---|
Product Name | Methyl({1-[2-(trifluoromethyl)phenyl]propan-2-yl})amine |
CAS | 1344274-22-1 |
Purity | 95% |
Molecular weight | 217.235 |
IUPAC Name | methyl({1-[2-(trifluoromethyl)phenyl]propan-2-yl})amine |
SMILES | CNC(C)CC1=CC=CC=C1C(F)(F)F |
INCHI Code | InChI=1/C11H14F3N/c1-8(15-2)7-9-5-3-4-6-10(9)11(12,13)14/h3-6,8,15H,7H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 3.1146793 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.45454547 |
Concept Codes | Phenyl, Secondary amine, Amine (P+S+T), Fluoro, Halo, N-methyl, Trifluoromethyl, Monosubstituted (ortho) trifluoromethylbenzene, Cyclic, Aromatic, PFA01, PFA02 |