4-Ethoxy-2,5-dimethylaniline
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F655951 |
---|---|
Product Name | 4-Ethoxy-2,5-dimethylaniline |
CAS | 706822-63-1 |
Purity | 97% |
Molecular weight | 165.236 |
IUPAC Name | 4-ethoxy-2,5-dimethylaniline |
SMILES | CCOC1=CC(C)=C(N)C=C1C |
INCHI Code | InChI=1S/C10H15NO/c1-4-12-10-6-7(2)9(11)5-8(10)3/h5-6H,4,11H2,1-3H3 |
Asymmetric atoms | 0 |
LogP | 2.3702993 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Ether, Primary amine, Amine (P+S+T), Methyl, Tolyl, Dimethyl, Aniline, Cyclic, Aromatic |