7,7-Dimethyl-2,6-dioxa-9-azaspiro[4.5]decane
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F655655 |
---|---|
Product Name | 7,7-Dimethyl-2,6-dioxa-9-azaspiro[4.5]decane |
CAS | 1486752-76-4 |
Purity | 95% |
Molecular weight | 171.24 |
IUPAC Name | 7,7-dimethyl-2,6-dioxa-9-azaspiro[4.5]decane |
SMILES | CC1(C)CNCC2(CCOC2)O1 |
INCHI Code | InChI=1/C9H17NO2/c1-8(2)5-10-6-9(12-8)3-4-11-7-9/h10H,3-7H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 0.11076784 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 1 |
Concept Codes | Ether, Heterocycle, Secondary amine, Amine (P+S+T), Methyl, Dimethyl, 5-Membered heterocycle, 6-Membered heterocycle, Spirocycle, Cyclic |