2-Chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)acetamide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F651339 |
---|---|
Product Name | 2-Chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)acetamide |
CAS | 103464-03-5 |
Purity | 95% |
Molecular weight | 247.74 |
IUPAC Name | 2-chloro-N-(2-methoxyethyl)-N-[(thiophen-2-yl)methyl]acetamide |
SMILES | COCCN(CC1=CC=CS1)C(=O)CCl |
INCHI Code | InChI=1S/C10H14ClNO2S/c1-14-5-4-12(10(13)7-11)8-9-3-2-6-15-9/h2-3,6H,4-5,7-8H2,1H3 |
Asymmetric atoms | 0 |
LogP | 1.5447866 |
H bond acceptors | 2 |
H bond donors | 0 |
fsp3 | 0.5 |
Concept Codes | Methoxy, Ether, Heterocycle, Heteroaromatic, Amide, Sulfide, Chloro, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |