3-Methoxy-1-(5-methylfuran-2-yl)propan-1-amine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F650973 |
---|---|
Product Name | 3-Methoxy-1-(5-methylfuran-2-yl)propan-1-amine |
CAS | 1432679-99-6 |
Purity | 95% |
Molecular weight | 169.224 |
IUPAC Name | 3-methoxy-1-(5-methylfuran-2-yl)propan-1-amine |
SMILES | COCCC(N)C1=CC=C(C)O1 |
INCHI Code | InChI=1/C9H15NO2/c1-7-3-4-9(12-7)8(10)5-6-11-2/h3-4,8H,5-6,10H2,1-2H3 |
Asymmetric atoms | 1 |
LogP | 0.4315735 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.5555556 |
Concept Codes | Methoxy, Ether, Heterocycle, Heteroaromatic, Primary amine, Amine (P+S+T), Methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Cyclic, Aromatic |