2-Methyl-2-[(2-phenoxyethyl)amino]propanoic acid hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F650964 |
---|---|
Product Name | 2-Methyl-2-[(2-phenoxyethyl)amino]propanoic acid hydrochloride |
CAS | 1432679-97-4 |
Purity | 95% |
Molecular weight | 259.73 |
IUPAC Name | 2-methyl-2-[(2-phenoxyethyl)amino]propanoic acid hydrochloride |
SMILES | Cl.CC(C)(NCCOC1=CC=CC=C1)C(O)=O |
INCHI Code | InChI=1S/C12H17NO3.ClH/c1-12(2,11(14)15)13-8-9-16-10-6-4-3-5-7-10;/h3-7,13H,8-9H2,1-2H3,(H,14,15);1H |
Asymmetric atoms | 0 |
LogP | -0.5403247 |
H bond acceptors | 4 |
H bond donors | 2 |
fsp3 | 0.41666666 |
Concept Codes | Phenyl, Carboxylic acid, Ether, Secondary amine, Amine (P+S+T), Hydrochloride, Amino acid, Cyclic, Aromatic |