3-(4-bromothiophen-2-yl)-2-hydroxyprop-2-enoic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F650533 |
---|---|
Product Name | 3-(4-bromothiophen-2-yl)-2-hydroxyprop-2-enoic acid |
CAS | 1155083-00-3 |
Purity | 98% |
Molecular weight | 249.08 |
IUPAC Name | 3-(4-bromothiophen-2-yl)-2-hydroxyprop-2-enoic acid |
SMILES | OC(=O)C(O)=CC1=CC(Br)=CS1 |
INCHI Code | InChI=1S/C7H5BrO3S/c8-4-1-5(12-3-4)2-6(9)7(10)11/h1-3,9H,(H,10,11) |
Asymmetric atoms | 0 |
LogP | 2.2990625 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.0 |
Concept Codes | Aliphatic alcohol, Carboxylic acid, Heterocycle, Heteroaromatic, Sulfide, Bromo, Halo, Alkene, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |