(2-Ethoxy-4-methylphenyl)methanamine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F649486 |
---|---|
Product Name | (2-Ethoxy-4-methylphenyl)methanamine |
CAS | 1248476-95-0 |
Purity | 95% |
Molecular weight | 165.236 |
IUPAC Name | 1-(2-ethoxy-4-methylphenyl)methanamine |
SMILES | CCOC1=CC(C)=CC=C1CN |
INCHI Code | InChI=1S/C10H15NO/c1-3-12-10-6-8(2)4-5-9(10)7-11/h4-6H,3,7,11H2,1-2H3 |
Asymmetric atoms | 0 |
LogP | 1.8115723 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Ether, Primary amine, Amine (P+S+T), Methyl, Tolyl, Cyclic, Aromatic |