Ethyl 5-(2-chloroacetamido)-4-cyano-2-methylfuran-3-carboxylate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F649480 |
---|---|
Product Name | Ethyl 5-(2-chloroacetamido)-4-cyano-2-methylfuran-3-carboxylate |
CAS | 855715-20-7 |
Purity | 95% |
Molecular weight | 270.67 |
IUPAC Name | ethyl 5-(2-chloroacetamido)-4-cyano-2-methylfuran-3-carboxylate |
SMILES | CCOC(=O)C1=C(C)OC(NC(=O)CCl)=C1C#N |
INCHI Code | InChI=1S/C11H11ClN2O4/c1-3-17-11(16)9-6(2)18-10(7(9)5-13)14-8(15)4-12/h3-4H2,1-2H3,(H,14,15) |
Asymmetric atoms | 0 |
LogP | 1.3937789 |
H bond acceptors | 3 |
H bond donors | 1 |
fsp3 | 0.36363637 |
Concept Codes | Ester, Heterocycle, Heteroaromatic, Amide, Nitrile, Chloro, Halo, Methyl, 5-Membered heteroaromatic, 5-Membered heterocycle, Furan, Cyclic, Aromatic |