1-(4-Tert-butylbenzenesulfonyl)piperidine-4-carboxylic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F648644 |
---|---|
Product Name | 1-(4-Tert-butylbenzenesulfonyl)piperidine-4-carboxylic acid |
CAS | 757192-86-2 |
Purity | 95% |
Molecular weight | 325.42 |
IUPAC Name | 1-(4-tert-butylbenzenesulfonyl)piperidine-4-carboxylic acid |
SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)N1CCC(CC1)C(O)=O |
INCHI Code | InChI=1S/C16H23NO4S/c1-16(2,3)13-4-6-14(7-5-13)22(20,21)17-10-8-12(9-11-17)15(18)19/h4-7,12H,8-11H2,1-3H3,(H,18,19) |
Asymmetric atoms | 0 |
LogP | 2.6447957 |
H bond acceptors | 4 |
H bond donors | 1 |
fsp3 | 0.5625 |
Concept Codes | Phenyl, Carboxylic acid, Heterocycle, Sulfonamide, 6-Membered heterocycle, Piperidine, Cyclic, Aromatic |