2-Chloro-4-ethynyl-1-methylbenzene
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F647914 |
---|---|
Product Name | 2-Chloro-4-ethynyl-1-methylbenzene |
CAS | 1338235-62-3 |
Purity | 98% |
Molecular weight | 150.61 |
IUPAC Name | 2-chloro-4-ethynyl-1-methylbenzene |
SMILES | CC1=CC=C(C=C1Cl)C#C |
INCHI Code | InChI=1S/C9H7Cl/c1-3-8-5-4-7(2)9(10)6-8/h1,4-6H,2H3 |
Asymmetric atoms | 0 |
LogP | 3.241547 |
H bond acceptors | 0 |
H bond donors | 0 |
fsp3 | 0.11111111 |
Concept Codes | Phenyl, Alkyne, Terminal alkyne, Terminal alkyne (aliphatic hydrocarbon), Terminal alkyne (aromatic hydrocarbon), Chloro, Halo, Methyl, Tolyl, Disubstituted (2,5)- monochlorobenzene, Monochlorobenzene, Cyclic, Aromatic, Phenylacetylene |