3-(Dimethylamino)benzene-1-sulfonyl chloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F645695 |
---|---|
Product Name | 3-(Dimethylamino)benzene-1-sulfonyl chloride |
CAS | 876482-47-2 |
Purity | 97% |
Molecular weight | 219.68 |
IUPAC Name | 3-(dimethylamino)benzene-1-sulfonyl chloride |
SMILES | CN(C)C1=CC(=CC=C1)S(Cl)(=O)=O |
INCHI Code | InChI=1S/C8H10ClNO2S/c1-10(2)7-4-3-5-8(6-7)13(9,11)12/h3-6H,1-2H3 |
Asymmetric atoms | 0 |
LogP | 2.0275927 |
H bond acceptors | 3 |
H bond donors | 0 |
fsp3 | 0.25 |
Concept Codes | Phenyl, Tertiary amine, Amine (P+S+T), Sulfonyl chloride, Chloro, Halo, N-methyl, Cyclic, Aromatic, Sulfonyl Chloride (RSO2Cl, R = C) |