2-(2-Chlorothiophen-3-yl)acetic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F645395 |
---|---|
Product Name | 2-(2-Chlorothiophen-3-yl)acetic acid |
CAS | 188718-23-2 |
Purity | 98% |
Molecular weight | 176.61 |
IUPAC Name | 2-(2-chlorothiophen-3-yl)acetic acid |
SMILES | OC(=O)CC1=C(Cl)SC=C1 |
INCHI Code | InChI=1S/C6H5ClO2S/c7-6-4(1-2-10-6)3-5(8)9/h1-2H,3H2,(H,8,9) |
Asymmetric atoms | 0 |
LogP | 2.1614766 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.16666667 |
Concept Codes | Carboxylic acid, Heterocycle, Heteroaromatic, Sulfide, Chloro, Halo, 5-Membered heteroaromatic, 5-Membered heterocycle, Thiophene, Cyclic, Aromatic |