3-(2-Chloroacetyl)-1-(2-fluorophenyl)urea
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F644842 |
---|---|
Product Name | 3-(2-Chloroacetyl)-1-(2-fluorophenyl)urea |
Other Names | 2-chloro-N-{[(2-fluorophenyl)amino]carbonyl}acetamide |
CAS | 790681-56-0 |
Purity | 95% |
Molecular weight | 230.62 |
IUPAC Name | 3-(2-chloroacetyl)-1-(2-fluorophenyl)urea |
SMILES | FC1=CC=CC=C1NC(=O)NC(=O)CCl |
INCHI Code | InChI=1S/C9H8ClFN2O2/c10-5-8(14)13-9(15)12-7-4-2-1-3-6(7)11/h1-4H,5H2,(H2,12,13,14,15) |
Asymmetric atoms | 0 |
LogP | 1.5460647 |
H bond acceptors | 2 |
H bond donors | 2 |
fsp3 | 0.11111111 |
Concept Codes | Phenyl, Fluoro, Chloro, Halo, Monofluorobenzene, Monosubstituted (ortho) monofluorobenzene, Cyclic, Aromatic |