2-(2-Ethyl-1h-1,3-benzodiazol-1-yl)acetohydrazide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F643085 |
---|---|
Product Name | 2-(2-Ethyl-1h-1,3-benzodiazol-1-yl)acetohydrazide |
CAS | 131717-37-8 |
Purity | 95% |
Molecular weight | 218.26 |
IUPAC Name | 2-(2-ethyl-1H-1,3-benzodiazol-1-yl)acetohydrazide |
SMILES | CCC1=NC2=CC=CC=C2N1CC(=O)NN |
INCHI Code | InChI=1S/C11H14N4O/c1-2-10-13-8-5-3-4-6-9(8)15(10)7-11(16)14-12/h3-6H,2,7,12H2,1H3,(H,14,16) |
Asymmetric atoms | 0 |
LogP | 0.68134564 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.27272728 |
Concept Codes | Heterocycle, Heteroaromatic, Ethyl, Hydrazide, 5-Membered heteroaromatic, 5-Membered heterocycle, Benzimidazole, Cyclic, Aromatic |