1-(2-Chloro-5-nitrobenzenesulfonyl)pyrrolidine
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F641768 |
---|---|
Product Name | 1-(2-Chloro-5-nitrobenzenesulfonyl)pyrrolidine |
Other Names | 1-(2-Chloro-5-nitro-benzenesulfonyl)-pyrrolidine |
CAS | 40833-70-3 |
Purity | 95% |
Molecular weight | 290.72 |
IUPAC Name | 1-(2-chloro-5-nitrobenzenesulfonyl)pyrrolidine |
SMILES | [O-][N+](=O)C1=CC=C(Cl)C(=C1)S(=O)(=O)N1CCCC1 |
INCHI Code | InChI=1S/C10H11ClN2O4S/c11-9-4-3-8(13(14)15)7-10(9)18(16,17)12-5-1-2-6-12/h3-4,7H,1-2,5-6H2 |
Asymmetric atoms | 0 |
LogP | 1.9764551 |
H bond acceptors | 4 |
H bond donors | 0 |
fsp3 | 0.4 |
Concept Codes | Phenyl, Heterocycle, Nitro, Chloro, Halo, Sulfonamide, 5-Membered heterocycle, Disubstituted (2,4)- monochlorobenzene, Monochlorobenzene, Pyrrolidine, Nitrobenzene, Cyclic, Aromatic, 1-Chloro-4-nitrobenzene, 1-Halo-4-nitrobenzene |