2-[(4-methoxy-3-nitrophenyl)formamido]acetic acid
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F641289 |
---|---|
Product Name | 2-[(4-methoxy-3-nitrophenyl)formamido]acetic acid |
CAS | 554407-07-7 |
Purity | 95% |
Molecular weight | 254.198 |
IUPAC Name | 2-[(4-methoxy-3-nitrophenyl)formamido]acetic acid |
SMILES | COC1=CC=C(C=C1[N+]([O-])=O)C(=O)NCC(O)=O |
INCHI Code | InChI=1S/C10H10N2O6/c1-18-8-3-2-6(4-7(8)12(16)17)10(15)11-5-9(13)14/h2-4H,5H2,1H3,(H,11,15)(H,13,14) |
Asymmetric atoms | 0 |
LogP | 0.3078584 |
H bond acceptors | 6 |
H bond donors | 2 |
fsp3 | 0.2 |
Concept Codes | Phenyl, Carboxylic acid, Methoxy, Ether, Amide, Nitro, Nitrobenzene, Cyclic, Aromatic, Anisole, Alpha-amino acid |