6-Bromo-1h,2h,3h,4h,5h-pyrido[4,3-b]indole hydrochloride
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F640486 |
---|---|
Product Name | 6-Bromo-1h,2h,3h,4h,5h-pyrido[4,3-b]indole hydrochloride |
CAS | 1059630-11-3 |
Purity | 98% |
Molecular weight | 287.59 |
IUPAC Name | 6-bromo-1H,2H,3H,4H,5H-pyrido[4,3-b]indole hydrochloride |
SMILES | Cl.BrC1=C2NC3=C(CNCC3)C2=CC=C1 |
INCHI Code | InChI=1S/C11H11BrN2.ClH/c12-9-3-1-2-7-8-6-13-5-4-10(8)14-11(7)9;/h1-3,13-14H,4-6H2;1H |
Asymmetric atoms | 0 |
LogP | 2.1302974 |
H bond acceptors | 1 |
H bond donors | 2 |
fsp3 | 0.27272728 |
Concept Codes | Heterocycle, Heteroaromatic, Secondary amine, Amine (P+S+T), Bromo, Halo, Hydrochloride, 5-Membered heteroaromatic, 5-Membered heterocycle, 6-Membered heterocycle, Cyclic, Aromatic, Pyrido[4,3-b]indole |