6-(Trifluoromethyl)-1,2-dihydroisoquinolin-1-one
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F639855 |
---|---|
Product Name | 6-(Trifluoromethyl)-1,2-dihydroisoquinolin-1-one |
Other Names | 6-(Trifluoromethyl)isoquinolin-1(2H)-one |
CAS | 1184916-59-3 |
Purity | 98+% |
Molecular weight | 213.159 |
IUPAC Name | 6-(trifluoromethyl)-1,2-dihydroisoquinolin-1-one |
SMILES | FC(F)(F)C1=CC=C2C(=O)NC=CC2=C1 |
INCHI Code | InChI=1S/C10H6F3NO/c11-10(12,13)7-1-2-8-6(5-7)3-4-14-9(8)15/h1-5H,(H,14,15) |
Asymmetric atoms | 0 |
LogP | 2.0599782 |
H bond acceptors | 1 |
H bond donors | 1 |
fsp3 | 0.1 |
Concept Codes | Heterocycle, Heteroaromatic, Fluoro, Halo, Trifluoromethyl, 6-Membered heteroaromatic, 6-Membered heterocycle, Isoquinoline, Cyclic, Aromatic, PFA01, PFA02 |