Methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F638387 |
---|---|
Product Name | Methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate |
CAS | 941294-24-2 |
Purity | 97% |
Molecular weight | 344.38 |
IUPAC Name | methyl 3,5-dibromo-4-chloro-2-hydroxybenzoate |
SMILES | COC(=O)C1=C(O)C(Br)=C(Cl)C(Br)=C1 |
INCHI Code | InChI=1S/C8H5Br2ClO3/c1-14-8(13)3-2-4(9)6(11)5(10)7(3)12/h2,12H,1H3 |
Asymmetric atoms | 0 |
LogP | 4.4647074 |
H bond acceptors | 2 |
H bond donors | 1 |
fsp3 | 0.125 |
Concept Codes | Phenyl, Ester, Chloro, Bromo, Halo, Aromatic alcohol, 1,3-Dibromobenzene, Dibromobenzene, Monochlorobenzene, Phenol, Cyclic, Aromatic, Benzoate |