2-[2-(Trifluoromethyl)phenoxy]acetohydrazide
SELECT YOUR REGION BELOW or log in to see your specific pricing and stock
Product Code | F637411 |
---|---|
Product Name | 2-[2-(Trifluoromethyl)phenoxy]acetohydrazide |
CAS | 874804-00-9 |
Purity | 98% |
Molecular weight | 234.178 |
IUPAC Name | 2-[2-(trifluoromethyl)phenoxy]acetohydrazide |
SMILES | NNC(=O)COC1=CC=CC=C1C(F)(F)F |
INCHI Code | InChI=1S/C9H9F3N2O2/c10-9(11,12)6-3-1-2-4-7(6)16-5-8(15)14-13/h1-4H,5,13H2,(H,14,15) |
Asymmetric atoms | 0 |
LogP | 1.067988 |
H bond acceptors | 3 |
H bond donors | 2 |
fsp3 | 0.22222222 |
Concept Codes | Phenyl, Ether, Fluoro, Halo, Trifluoromethyl, Hydrazide, Monosubstituted (ortho) trifluoromethylbenzene, Cyclic, Aromatic, PFA01, PFA02 |